C18H18O6 — CID 102410551
1,5,9,13,17-pentamethyl-4,8,12,16-tetraoxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),5,10(15),13-tetraene-3,11-dione (PubChem CID 102410551) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is 1,5,9,13,17-pentamethyl-4,8,12,16-tetraoxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),5,10(15),13-tetraene-3,11-dione.
| Compound Name | 1,5,9,13,17-pentamethyl-4,8,12,16-tetraoxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),5,10(15),13-tetraene-3,11-dione |
|---|---|
| PubChem CID | 102410551 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1,5,9,13,17-pentamethyl-4,8,12,16-tetraoxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),5,10(15),13-tetraene-3,11-dione |
| SMILES | Cc1cc2c(c(=O)o1)C1(C)Oc3cc(C)oc(=O)c3C(C)(O2)C1C |
| InChI | InChI=1S/C18H18O6/c1-8-6-11-13(15(19)21-8)17(4)10(3)18(5,23-11)14-12(24-17)7-9(2)22-16(14)20/h6-7,10H,1-5H3 |
| InChIKey | MEKIEFWYZSLGLS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |