C10H22N4 — CID 102410582
(3R,4R,7R,8R)-deca-1,9-diene-3,4,7,8-tetramine (PubChem CID 102410582) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is (3R,4R,7R,8R)-deca-1,9-diene-3,4,7,8-tetramine.
| Compound Name | (3R,4R,7R,8R)-deca-1,9-diene-3,4,7,8-tetramine |
|---|---|
| PubChem CID | 102410582 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | (3R,4R,7R,8R)-deca-1,9-diene-3,4,7,8-tetramine |
| SMILES | C=C[C@@H](N)[C@H](N)CC[C@@H](N)[C@H](N)C=C |
| InChI | InChI=1S/C10H22N4/c1-3-7(11)9(13)5-6-10(14)8(12)4-2/h3-4,7-10H,1-2,5-6,11-14H2/t7-,8-,9-,10-/m1/s1 |
| InChIKey | GHZDXBYBOSCKGE-ZYUZMQFOSA-N |
| XLogP | -0.55 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|