C24H23NO2S — CID 102410746
N-[(1S)-1,5-diphenylpent-2-ynyl]-4-methylbenzenesulfonamide (PubChem CID 102410746) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[(1S)-1,5-diphenylpent-2-ynyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S)-1,5-diphenylpent-2-ynyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102410746 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[(1S)-1,5-diphenylpent-2-ynyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C#CCCc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23NO2S/c1-20-16-18-23(19-17-20)28(26,27)25-24(22-13-6-3-7-14-22)15-9-8-12-21-10-4-2-5-11-21/h2-7,10-11,13-14,16-19,24-25H,8,12H2,1H3/t24-/m1/s1 |
| InChIKey | QXHZGQUVZFOVJP-XMMPIXPASA-N |
| XLogP | 4.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|