C6H9NO2S — CID 10241080
(3-ethoxy-1,2-thiazol-5-yl)methanol (PubChem CID 10241080) has the molecular formula C6H9NO2S and a molecular weight of 159.21 g/mol. Its IUPAC name is (3-ethoxy-1,2-thiazol-5-yl)methanol.
| Compound Name | (3-ethoxy-1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 10241080 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | (3-ethoxy-1,2-thiazol-5-yl)methanol |
| SMILES | CCOc1cc(CO)sn1 |
| InChI | InChI=1S/C6H9NO2S/c1-2-9-6-3-5(4-8)10-7-6/h3,8H,2,4H2,1H3 |
| InChIKey | MALBEVJIAXSSOC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |