About 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran
2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran (PubChem CID 10241088) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran |
| PubChem CID | 10241088 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran |
| SMILES | C=C(C)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C11H12O/c1-8(2)11-7-9-5-3-4-6-10(9)12-11/h3-6,11H,1,7H2,2H3 |
| InChIKey | DMSKTCLGSUVYMN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran?
The IUPAC name of 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran (CID 10241088) is 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran?
The canonical SMILES for 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran is C=C(C)C1Cc2ccccc2O1.
What is the InChIKey of 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran?
The InChIKey is DMSKTCLGSUVYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O/c1-8(2)11-7-9-5-3-4-6-10(9)12-11/h3-6,11H,1,7H2,2H3.
What are the key properties of 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran?
2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran has a molecular weight of 160.22 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-1-en-2-yl-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 10241088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).