4-cyano-3-methylbenzoic acid

C9H7NO2 — CID 10241099

IUPAC4-cyano-3-methylbenzoic acid
SMILESCc1cc(C(=O)O)ccc1C#N
InChIInChI=1S/C9H7NO2/c1-6-4-7(9(11)12)2-3-8(6)5-10/h2-4H,1H3,(H,11,12)
InChIKeyLTRYUAZFLOGRLJ-UHFFFAOYSA-N
MW161.16 g/mol
LogP1.56
Rot. Bonds1

About 4-cyano-3-methylbenzoic acid

4-cyano-3-methylbenzoic acid (PubChem CID 10241099) has the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. Its IUPAC name is 4-cyano-3-methylbenzoic acid.

Molecular Properties

Compound Name4-cyano-3-methylbenzoic acid
PubChem CID10241099
Molecular FormulaC9H7NO2
Molecular Weight161.16 g/mol
Exact Mass161.05
IUPAC Name4-cyano-3-methylbenzoic acid
SMILESCc1cc(C(=O)O)ccc1C#N
InChIInChI=1S/C9H7NO2/c1-6-4-7(9(11)12)2-3-8(6)5-10/h2-4H,1H3,(H,11,12)
InChIKeyLTRYUAZFLOGRLJ-UHFFFAOYSA-N
XLogP1.56
TPSA61.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.16
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-cyano-3-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-cyano-3-methylbenzoic acid?
The IUPAC name of 4-cyano-3-methylbenzoic acid (CID 10241099) is 4-cyano-3-methylbenzoic acid.
What is the SMILES notation for 4-cyano-3-methylbenzoic acid?
The canonical SMILES for 4-cyano-3-methylbenzoic acid is Cc1cc(C(=O)O)ccc1C#N.
What is the InChIKey of 4-cyano-3-methylbenzoic acid?
The InChIKey is LTRYUAZFLOGRLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c1-6-4-7(9(11)12)2-3-8(6)5-10/h2-4H,1H3,(H,11,12).
What are the key properties of 4-cyano-3-methylbenzoic acid?
4-cyano-3-methylbenzoic acid has a molecular weight of 161.16 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-3-methylbenzoic acid is sourced from PubChem (CID 10241099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).