C10H12O2 — CID 10241128
2-but-3-ynyl-2-methylcyclopentane-1,3-dione (PubChem CID 10241128) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-but-3-ynyl-2-methylcyclopentane-1,3-dione.
| Compound Name | 2-but-3-ynyl-2-methylcyclopentane-1,3-dione |
|---|---|
| PubChem CID | 10241128 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-but-3-ynyl-2-methylcyclopentane-1,3-dione |
| SMILES | C#CCCC1(C)C(=O)CCC1=O |
| InChI | InChI=1S/C10H12O2/c1-3-4-7-10(2)8(11)5-6-9(10)12/h1H,4-7H2,2H3 |
| InChIKey | OMYBVUCBIXBDIS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|