C25H21F3N2O3S — CID 102411343
[1-(2-cyclohexylquinazolin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 102411343) has the molecular formula C25H21F3N2O3S and a molecular weight of 486.52 g/mol. Its IUPAC name is [1-(2-cyclohexylquinazolin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [1-(2-cyclohexylquinazolin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102411343 |
| Molecular Formula | C25H21F3N2O3S |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | [1-(2-cyclohexylquinazolin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2ccccc2c1-c1nc(C2CCCCC2)nc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C25H21F3N2O3S/c26-25(27,28)34(31,32)33-21-15-14-16-8-4-5-11-18(16)22(21)23-19-12-6-7-13-20(19)29-24(30-23)17-9-2-1-3-10-17/h4-8,11-15,17H,1-3,9-10H2 |
| InChIKey | LELHBFSEYVKFNX-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|