C84H104O15 — CID 102411642
2-(2-hydroxyethoxy)ethyl 4-[[3,5-bis[[3,4-bis[(4-hexoxyphenyl)methoxy]phenyl]methoxy]phenyl]methoxy]benzoate (PubChem CID 102411642) has the molecular formula C84H104O15 and a molecular weight of 1353.74 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 4-[[3,5-bis[[3,4-bis[(4-hexoxyphenyl)methoxy]phenyl]methoxy]phenyl]methoxy]benzoate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 4-[[3,5-bis[[3,4-bis[(4-hexoxyphenyl)methoxy]phenyl]methoxy]phenyl]methoxy]benzoate |
|---|---|
| PubChem CID | 102411642 |
| Molecular Formula | C84H104O15 |
| Molecular Weight | 1353.74 g/mol |
| Exact Mass | 1352.74 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 4-[[3,5-bis[[3,4-bis[(4-hexoxyphenyl)methoxy]phenyl]methoxy]phenyl]methoxy]benzoate |
| SMILES | CCCCCCOc1ccc(COc2ccc(COc3cc(COc4ccc(C(=O)OCCOCCO)cc4)cc(OCc4ccc(OCc5ccc(OCCCCCC)cc5)c(OCc5ccc(OCCCCCC)cc5)c4)c3)cc2OCc2ccc(OCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C84H104O15/c1-5-9-13-17-46-88-73-33-21-65(22-34-73)58-96-80-43-29-69(55-82(80)98-60-67-25-37-75(38-26-67)90-48-19-15-11-7-3)62-94-78-53-71(64-93-77-41-31-72(32-42-77)84(86)92-52-51-87-50-45-85)54-79(57-78)95-63-70-30-44-81(97-59-66-23-35-74(36-24-66)89-47-18-14-10-6-2)83(56-70)99-61-68-27-39-76(40-28-68)91-49-20-16-12-8-4/h21-44,53-57,85H,5-20,45-52,58-64H2,1-4H3 |
| InChIKey | BMLZIZCTDVEBIR-UHFFFAOYSA-N |
| XLogP | 19.74 |
| TPSA | 157.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 99 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1353.74 |
| LogP ≤ 5 | 19.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|