C13H22O7 — CID 102411832
(2S,3aS,4S,5R,6S,6aR)-2-hydroxy-4,5,6-trimethoxy-6a-(methoxymethyl)-2-methyl-3a,4,5,6-tetrahydrocyclopenta[b]furan-3-one (PubChem CID 102411832) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is (2S,3aS,4S,5R,6S,6aR)-2-hydroxy-4,5,6-trimethoxy-6a-(methoxymethyl)-2-methyl-3a,4,5,6-tetrahydrocyclopenta[b]furan-3-one.
| Compound Name | (2S,3aS,4S,5R,6S,6aR)-2-hydroxy-4,5,6-trimethoxy-6a-(methoxymethyl)-2-methyl-3a,4,5,6-tetrahydrocyclopenta[b]furan-3-one |
|---|---|
| PubChem CID | 102411832 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (2S,3aS,4S,5R,6S,6aR)-2-hydroxy-4,5,6-trimethoxy-6a-(methoxymethyl)-2-methyl-3a,4,5,6-tetrahydrocyclopenta[b]furan-3-one |
| SMILES | COC[C@]12O[C@](C)(O)C(=O)[C@H]1[C@H](OC)[C@@H](OC)[C@@H]2OC |
| InChI | InChI=1S/C13H22O7/c1-12(15)10(14)7-8(17-3)9(18-4)11(19-5)13(7,20-12)6-16-2/h7-9,11,15H,6H2,1-5H3/t7-,8+,9-,11+,12+,13+/m1/s1 |
| InChIKey | HENLUFKNGGCXOP-DEJPRZHYSA-N |
| XLogP | -0.65 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |