C11H18O4 — CID 102412001
trans-ethyl (1R,3S)-1-ethyl-3-(hydroxymethyl)-3-methyl-2-oxocyclobutane-1-carboxylate (PubChem CID 102412001) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is trans-ethyl (1R,3S)-1-ethyl-3-(hydroxymethyl)-3-methyl-2-oxocyclobutane-1-carboxylate.
| Compound Name | trans-ethyl (1R,3S)-1-ethyl-3-(hydroxymethyl)-3-methyl-2-oxocyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 102412001 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | trans-ethyl (1R,3S)-1-ethyl-3-(hydroxymethyl)-3-methyl-2-oxocyclobutane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(CC)C[C@@](C)(CO)C1=O |
| InChI | InChI=1S/C11H18O4/c1-4-11(9(14)15-5-2)6-10(3,7-12)8(11)13/h12H,4-7H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | NSWAOXNESXFJNI-WDEREUQCSA-N |
| XLogP | 0.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|