C14H18O5 — CID 102412042
[(1R,2S,3R,4S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] hex-5-enoate (PubChem CID 102412042) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is [(1R,2S,3R,4S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] hex-5-enoate.
| Compound Name | [(1R,2S,3R,4S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] hex-5-enoate |
|---|---|
| PubChem CID | 102412042 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [(1R,2S,3R,4S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] hex-5-enoate |
| SMILES | C=CCCCC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C14H18O5/c1-3-4-5-6-12(16)19-14-11-8-7-10(18-11)13(14)17-9(2)15/h3,7-8,10-11,13-14H,1,4-6H2,2H3/t10-,11+,13+,14-/m0/s1 |
| InChIKey | FMWPWSGEFNTQFM-UNJBNNCHSA-N |
| XLogP | 1.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|