C18H25NO3 — CID 102412244
tert-butyl N-[(2S,3S,4Z)-3-hydroxy-1-phenylhepta-4,6-dien-2-yl]carbamate (PubChem CID 102412244) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,4Z)-3-hydroxy-1-phenylhepta-4,6-dien-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,4Z)-3-hydroxy-1-phenylhepta-4,6-dien-2-yl]carbamate |
|---|---|
| PubChem CID | 102412244 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | tert-butyl N-[(2S,3S,4Z)-3-hydroxy-1-phenylhepta-4,6-dien-2-yl]carbamate |
| SMILES | C=C/C=C\[C@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO3/c1-5-6-12-16(20)15(13-14-10-8-7-9-11-14)19-17(21)22-18(2,3)4/h5-12,15-16,20H,1,13H2,2-4H3,(H,19,21)/b12-6-/t15-,16-/m0/s1 |
| InChIKey | LGVUKUICALPCEU-BDZIDZOKSA-N |
| XLogP | 3.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|