About 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine
2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 10241226) has the molecular formula C7H8ClN3
and a molecular weight of 169.62 g/mol. Its IUPAC name is 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| PubChem CID | 10241226 |
| Molecular Formula | C7H8ClN3 |
| Molecular Weight | 169.62 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | Nc1nc(Cl)nc2c1CCC2 |
| InChI | InChI=1S/C7H8ClN3/c8-7-10-5-3-1-2-4(5)6(9)11-7/h1-3H2,(H2,9,10,11) |
| InChIKey | FLSZZRQYAPQBEO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.62 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The IUPAC name of 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (CID 10241226) is 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
What is the SMILES notation for 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The canonical SMILES for 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is Nc1nc(Cl)nc2c1CCC2.
What is the InChIKey of 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The InChIKey is FLSZZRQYAPQBEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN3/c8-7-10-5-3-1-2-4(5)6(9)11-7/h1-3H2,(H2,9,10,11).
What are the key properties of 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine has a molecular weight of 169.62 g/mol, XLogP of 1.20, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is sourced from PubChem (CID 10241226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).