About CID 102412482
CID 102412482 (PubChem CID 102412482) has the molecular formula C34H46N3O14P2+2
and a molecular weight of 782.70 g/mol.
Molecular Properties
| Compound Name | CID 102412482 |
| PubChem CID | 102412482 |
| Molecular Formula | C34H46N3O14P2+2 |
| Molecular Weight | 782.70 g/mol |
| Exact Mass | 782.24 |
| IUPAC Name | — |
| SMILES | Cc1cn([C@H]2CC[C@@H](CO[P+]([O-])(O[NH3+])O[P+]([O-])(OCc3ccc(OC(=O)C(C)(C)C)cc3)OCc3ccc(OC(=[O+])C(C)(C)C)cc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C34H45N3O14P2/c1-22-18-37(32(41)36-29(22)38)28-17-16-27(47-28)21-46-53(43,50-35)51-52(42,44-19-23-8-12-25(13-9-23)48-30(39)33(2,3)4)45-20-24-10-14-26(15-11-24)49-31(40)34(5,6)7/h8-15,18,27-28H,16-17,19-21H2,1-7,35H3/q+1/p+1/t27-,28+,53?/m0/s1 |
| InChIKey | RGSBMYMJJYNFRD-KWNKOPKGSA-O |
| XLogP | 3.14 |
| TPSA | 239.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 782.70 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 102412482 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102412482?
The IUPAC name of CID 102412482 (CID 102412482) is not available.
What is the SMILES notation for CID 102412482?
The canonical SMILES for CID 102412482 is Cc1cn([C@H]2CC[C@@H](CO[P+]([O-])(O[NH3+])O[P+]([O-])(OCc3ccc(OC(=O)C(C)(C)C)cc3)OCc3ccc(OC(=[O+])C(C)(C)C)cc3)O2)c(=O)[nH]c1=O.
What is the InChIKey of CID 102412482?
The InChIKey is RGSBMYMJJYNFRD-KWNKOPKGSA-O. The full InChI is InChI=1S/C34H45N3O14P2/c1-22-18-37(32(41)36-29(22)38)28-17-16-27(47-28)21-46-53(43,50-35)51-52(42,44-19-23-8-12-25(13-9-23)48-30(39)33(2,3)4)45-20-24-10-14-26(15-11-24)49-31(40)34(5,6)7/h8-15,18,27-28H,16-17,19-21H2,1-7,35H3/q+1/p+1/t27-,28+,53?/m0/s1.
What are the key properties of CID 102412482?
CID 102412482 has a molecular weight of 782.70 g/mol, XLogP of 3.14, 15 rotatable bonds, 2 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102412482 is sourced from PubChem (CID 102412482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).