About 3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile
3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile (PubChem CID 10241308) has the molecular formula C6H4N6O
and a molecular weight of 176.14 g/mol. Its IUPAC name is 3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile.
Analyze 3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile?
The IUPAC name of 3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile (CID 10241308) is 3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile.
What is the SMILES notation for 3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile?
The canonical SMILES for 3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile is N#Cc1nc2c(N)onc2nc1N.
What is the InChIKey of 3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile?
The InChIKey is CSQAYYLBFCVGOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N6O/c7-1-2-4(8)11-6-3(10-2)5(9)13-12-6/h9H2,(H2,8,11,12).
What are the key properties of 3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile?
3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile has a molecular weight of 176.14 g/mol, XLogP of -0.35, 0 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diamino-[1,2]oxazolo[3,4-b]pyrazine-5-carbonitrile is sourced from PubChem (CID 10241308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).