C20H24O3 — CID 102413318
2-[(4aR,5S,7R)-1,1,7-trimethyl-6-oxo-3,4,4a,5,7,8-hexahydro-2H-benzo[7]annulen-5-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 102413318) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[(4aR,5S,7R)-1,1,7-trimethyl-6-oxo-3,4,4a,5,7,8-hexahydro-2H-benzo[7]annulen-5-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(4aR,5S,7R)-1,1,7-trimethyl-6-oxo-3,4,4a,5,7,8-hexahydro-2H-benzo[7]annulen-5-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 102413318 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-[(4aR,5S,7R)-1,1,7-trimethyl-6-oxo-3,4,4a,5,7,8-hexahydro-2H-benzo[7]annulen-5-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | C[C@@H]1CC=C2[C@H](CCCC2(C)C)[C@@H](C2=CC(=O)C=CC2=O)C1=O |
| InChI | InChI=1S/C20H24O3/c1-12-6-8-16-14(5-4-10-20(16,2)3)18(19(12)23)15-11-13(21)7-9-17(15)22/h7-9,11-12,14,18H,4-6,10H2,1-3H3/t12-,14+,18+/m1/s1 |
| InChIKey | BSPPKQZRBVVLAB-IAISJRAMSA-N |
| XLogP | 3.60 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|