C14H17NO7 — CID 102413831
ethyl 2-[(3,4-dimethoxy-2-nitrophenyl)-hydroxymethyl]prop-2-enoate (PubChem CID 102413831) has the molecular formula C14H17NO7 and a molecular weight of 311.29 g/mol. Its IUPAC name is ethyl 2-[(3,4-dimethoxy-2-nitrophenyl)-hydroxymethyl]prop-2-enoate.
| Compound Name | ethyl 2-[(3,4-dimethoxy-2-nitrophenyl)-hydroxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 102413831 |
| Molecular Formula | C14H17NO7 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | ethyl 2-[(3,4-dimethoxy-2-nitrophenyl)-hydroxymethyl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)C(O)c1ccc(OC)c(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17NO7/c1-5-22-14(17)8(2)12(16)9-6-7-10(20-3)13(21-4)11(9)15(18)19/h6-7,12,16H,2,5H2,1,3-4H3 |
| InChIKey | VXZREMTXLMAYJG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|