C17H18BrF2S+ — CID 102414273
[bromo(difluoro)methyl]-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium (PubChem CID 102414273) has the molecular formula C17H18BrF2S+ and a molecular weight of 372.30 g/mol. Its IUPAC name is [bromo(difluoro)methyl]-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium.
| Compound Name | [bromo(difluoro)methyl]-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium |
|---|---|
| PubChem CID | 102414273 |
| Molecular Formula | C17H18BrF2S+ |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | [bromo(difluoro)methyl]-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)C(F)(F)Br)c(C)c(C)c1C |
| InChI | InChI=1S/C17H18BrF2S/c1-11-10-16(14(4)13(3)12(11)2)21(17(18,19)20)15-8-6-5-7-9-15/h5-10H,1-4H3/q+1 |
| InChIKey | WLGDHQLBDRTNRS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|