C10H14O3 — CID 10241444
(2R,6E)-2-methyl-2,3,4,5-tetrahydrooxecine-8,10-dione (PubChem CID 10241444) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (2R,6E)-2-methyl-2,3,4,5-tetrahydrooxecine-8,10-dione.
| Compound Name | (2R,6E)-2-methyl-2,3,4,5-tetrahydrooxecine-8,10-dione |
|---|---|
| PubChem CID | 10241444 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (2R,6E)-2-methyl-2,3,4,5-tetrahydrooxecine-8,10-dione |
| SMILES | C[C@@H]1CCC/C=C/C(=O)CC(=O)O1 |
| InChI | InChI=1S/C10H14O3/c1-8-5-3-2-4-6-9(11)7-10(12)13-8/h4,6,8H,2-3,5,7H2,1H3/b6-4+/t8-/m1/s1 |
| InChIKey | WUUZOPMVRPRTDR-YZCDNWJKSA-N |
| XLogP | 1.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|