C9H16O2Si — CID 10241504
(1S,2S)-3-trimethylsilylcyclohexa-3,5-diene-1,2-diol (PubChem CID 10241504) has the molecular formula C9H16O2Si and a molecular weight of 184.31 g/mol. Its IUPAC name is (1S,2S)-3-trimethylsilylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2S)-3-trimethylsilylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 10241504 |
| Molecular Formula | C9H16O2Si |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | (1S,2S)-3-trimethylsilylcyclohexa-3,5-diene-1,2-diol |
| SMILES | C[Si](C)(C)C1=CC=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H16O2Si/c1-12(2,3)8-6-4-5-7(10)9(8)11/h4-7,9-11H,1-3H3/t7-,9-/m0/s1 |
| InChIKey | WNVRRVLAMAEDPI-CBAPKCEASA-N |
| XLogP | 1.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|