About 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one
4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one (PubChem CID 102415199) has the molecular formula C10H9FO2
and a molecular weight of 180.18 g/mol. Its IUPAC name is 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one |
| PubChem CID | 102415199 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one |
| SMILES | Cc1ccc2c(c1F)C(O)CC2=O |
| InChI | InChI=1S/C10H9FO2/c1-5-2-3-6-7(12)4-8(13)9(6)10(5)11/h2-3,8,13H,4H2,1H3 |
| InChIKey | MIYHYVXOUSXMNQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one?
The IUPAC name of 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one (CID 102415199) is 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one.
What is the SMILES notation for 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one?
The canonical SMILES for 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one is Cc1ccc2c(c1F)C(O)CC2=O.
What is the InChIKey of 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one?
The InChIKey is MIYHYVXOUSXMNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO2/c1-5-2-3-6-7(12)4-8(13)9(6)10(5)11/h2-3,8,13H,4H2,1H3.
What are the key properties of 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one?
4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one has a molecular weight of 180.18 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-hydroxy-5-methyl-2,3-dihydroinden-1-one is sourced from PubChem (CID 102415199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).