C9H15NOS — CID 10241521
(5aR,9aS)-4,5,5a,6,7,8,9,9a-octahydrobenzo[f][1,4]oxazepine-3-thione (PubChem CID 10241521) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is (5aR,9aS)-4,5,5a,6,7,8,9,9a-octahydrobenzo[f][1,4]oxazepine-3-thione.
| Compound Name | (5aR,9aS)-4,5,5a,6,7,8,9,9a-octahydrobenzo[f][1,4]oxazepine-3-thione |
|---|---|
| PubChem CID | 10241521 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | (5aR,9aS)-4,5,5a,6,7,8,9,9a-octahydrobenzo[f][1,4]oxazepine-3-thione |
| SMILES | S=C1CO[C@H]2CCCC[C@@H]2CN1 |
| InChI | InChI=1S/C9H15NOS/c12-9-6-11-8-4-2-1-3-7(8)5-10-9/h7-8H,1-6H2,(H,10,12)/t7-,8+/m1/s1 |
| InChIKey | GNIQVODPRXXNJL-SFYZADRCSA-N |
| XLogP | 1.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|