ethyl 2-(3,3-dimethyloxolan-2-yl)acetate

C10H18O3 — CID 10241530

IUPACethyl 2-(3,3-dimethyloxolan-2-yl)acetate
SMILESCCOC(=O)CC1OCCC1(C)C
InChIInChI=1S/C10H18O3/c1-4-12-9(11)7-8-10(2,3)5-6-13-8/h8H,4-7H2,1-3H3
InChIKeyWKDROMJYXMBEHS-UHFFFAOYSA-N
MW186.25 g/mol
LogP1.75
Rot. Bonds3

About ethyl 2-(3,3-dimethyloxolan-2-yl)acetate

ethyl 2-(3,3-dimethyloxolan-2-yl)acetate (PubChem CID 10241530) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is ethyl 2-(3,3-dimethyloxolan-2-yl)acetate.

Molecular Properties

Compound Nameethyl 2-(3,3-dimethyloxolan-2-yl)acetate
PubChem CID10241530
Molecular FormulaC10H18O3
Molecular Weight186.25 g/mol
Exact Mass186.13
IUPAC Nameethyl 2-(3,3-dimethyloxolan-2-yl)acetate
SMILESCCOC(=O)CC1OCCC1(C)C
InChIInChI=1S/C10H18O3/c1-4-12-9(11)7-8-10(2,3)5-6-13-8/h8H,4-7H2,1-3H3
InChIKeyWKDROMJYXMBEHS-UHFFFAOYSA-N
XLogP1.75
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.25
LogP ≤ 51.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 2-(3,3-dimethyloxolan-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(3,3-dimethyloxolan-2-yl)acetate?
The IUPAC name of ethyl 2-(3,3-dimethyloxolan-2-yl)acetate (CID 10241530) is ethyl 2-(3,3-dimethyloxolan-2-yl)acetate.
What is the SMILES notation for ethyl 2-(3,3-dimethyloxolan-2-yl)acetate?
The canonical SMILES for ethyl 2-(3,3-dimethyloxolan-2-yl)acetate is CCOC(=O)CC1OCCC1(C)C.
What is the InChIKey of ethyl 2-(3,3-dimethyloxolan-2-yl)acetate?
The InChIKey is WKDROMJYXMBEHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-4-12-9(11)7-8-10(2,3)5-6-13-8/h8H,4-7H2,1-3H3.
What are the key properties of ethyl 2-(3,3-dimethyloxolan-2-yl)acetate?
ethyl 2-(3,3-dimethyloxolan-2-yl)acetate has a molecular weight of 186.25 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3,3-dimethyloxolan-2-yl)acetate is sourced from PubChem (CID 10241530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).