C71H88F2Si — CID 102415333
[2,6-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]phenyl]methyl-tert-butyl-difluorosilane (PubChem CID 102415333) has the molecular formula C71H88F2Si and a molecular weight of 1007.57 g/mol. Its IUPAC name is [2,6-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]phenyl]methyl-tert-butyl-difluorosilane.
| Compound Name | [2,6-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]phenyl]methyl-tert-butyl-difluorosilane |
|---|---|
| PubChem CID | 102415333 |
| Molecular Formula | C71H88F2Si |
| Molecular Weight | 1007.57 g/mol |
| Exact Mass | 1006.66 |
| IUPAC Name | [2,6-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]phenyl]methyl-tert-butyl-difluorosilane |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cc(-c2cccc(-c3cc(-c4c(C(C)C)cccc4C(C)C)cc(-c4c(C(C)C)cccc4C(C)C)c3)c2C[Si](F)(F)C(C)(C)C)cc(-c2c(C(C)C)cccc2C(C)C)c1 |
| InChI | InChI=1S/C71H88F2Si/c1-42(2)56-25-20-26-57(43(3)4)67(56)52-35-50(36-53(39-52)68-58(44(5)6)27-21-28-59(68)45(7)8)64-33-24-34-65(66(64)41-74(72,73)71(17,18)19)51-37-54(69-60(46(9)10)29-22-30-61(69)47(11)12)40-55(38-51)70-62(48(13)14)31-23-32-63(70)49(15)16/h20-40,42-49H,41H2,1-19H3 |
| InChIKey | LUHFJVJYHFNAJH-UHFFFAOYSA-N |
| XLogP | 22.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.57 |
| LogP ≤ 5 | 22.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|