C9H10N4O — CID 10241618
6-amino-7-prop-2-enyl-3,5-dihydroimidazo[4,5-c]pyridin-4-one (PubChem CID 10241618) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 6-amino-7-prop-2-enyl-3,5-dihydroimidazo[4,5-c]pyridin-4-one.
| Compound Name | 6-amino-7-prop-2-enyl-3,5-dihydroimidazo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 10241618 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 6-amino-7-prop-2-enyl-3,5-dihydroimidazo[4,5-c]pyridin-4-one |
| SMILES | C=CCc1c(N)[nH]c(=O)c2[nH]cnc12 |
| InChI | InChI=1S/C9H10N4O/c1-2-3-5-6-7(12-4-11-6)9(14)13-8(5)10/h2,4H,1,3H2,(H,11,12)(H3,10,13,14) |
| InChIKey | RODRLEDQZBTQSV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|