C22H17F3O5S — CID 102416394
[10-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1H-anthracen-9-yl] trifluoromethanesulfonate (PubChem CID 102416394) has the molecular formula C22H17F3O5S and a molecular weight of 450.43 g/mol. Its IUPAC name is [10-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1H-anthracen-9-yl] trifluoromethanesulfonate.
| Compound Name | [10-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1H-anthracen-9-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102416394 |
| Molecular Formula | C22H17F3O5S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | [10-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1H-anthracen-9-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(-c2c3c(c(OS(=O)(=O)C(F)(F)F)c4ccccc24)CCCC3=O)cc1 |
| InChI | InChI=1S/C22H17F3O5S/c1-29-14-11-9-13(10-12-14)19-15-5-2-3-6-16(15)21(30-31(27,28)22(23,24)25)17-7-4-8-18(26)20(17)19/h2-3,5-6,9-12H,4,7-8H2,1H3 |
| InChIKey | ORSIQCNCOOFDGN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|