C9H11N3O2 — CID 10241692
3-propyl-1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 10241692) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 3-propyl-1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-propyl-1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10241692 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-propyl-1,5-dihydropyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | CCCn1c(=O)[nH]c2cc[nH]c2c1=O |
| InChI | InChI=1S/C9H11N3O2/c1-2-5-12-8(13)7-6(3-4-10-7)11-9(12)14/h3-4,10H,2,5H2,1H3,(H,11,14) |
| InChIKey | GGZLRERBMNCFJH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |