C25H27NO7 — CID 102416946
(2R,3S,4R)-2-ethenyl-3-hydroxy-3-methyl-5-oxo-1-phenylmethoxycarbonyl-4-(2-phenylmethoxyethyl)pyrrolidine-2-carboxylic acid (PubChem CID 102416946) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is (2R,3S,4R)-2-ethenyl-3-hydroxy-3-methyl-5-oxo-1-phenylmethoxycarbonyl-4-(2-phenylmethoxyethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3S,4R)-2-ethenyl-3-hydroxy-3-methyl-5-oxo-1-phenylmethoxycarbonyl-4-(2-phenylmethoxyethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 102416946 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | (2R,3S,4R)-2-ethenyl-3-hydroxy-3-methyl-5-oxo-1-phenylmethoxycarbonyl-4-(2-phenylmethoxyethyl)pyrrolidine-2-carboxylic acid |
| SMILES | C=C[C@@]1(C(=O)O)N(C(=O)OCc2ccccc2)C(=O)[C@H](CCOCc2ccccc2)[C@]1(C)O |
| InChI | InChI=1S/C25H27NO7/c1-3-25(22(28)29)24(2,31)20(14-15-32-16-18-10-6-4-7-11-18)21(27)26(25)23(30)33-17-19-12-8-5-9-13-19/h3-13,20,31H,1,14-17H2,2H3,(H,28,29)/t20-,24-,25-/m0/s1 |
| InChIKey | WNYQMPVBQUFODG-OPXMRZJTSA-N |
| XLogP | 3.15 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|