C25H27NO6 — CID 102416951
benzyl (2R,3S,4R)-2-ethenyl-2-formyl-3-hydroxy-3-methyl-5-oxo-4-(2-phenylmethoxyethyl)pyrrolidine-1-carboxylate (PubChem CID 102416951) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is benzyl (2R,3S,4R)-2-ethenyl-2-formyl-3-hydroxy-3-methyl-5-oxo-4-(2-phenylmethoxyethyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3S,4R)-2-ethenyl-2-formyl-3-hydroxy-3-methyl-5-oxo-4-(2-phenylmethoxyethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102416951 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | benzyl (2R,3S,4R)-2-ethenyl-2-formyl-3-hydroxy-3-methyl-5-oxo-4-(2-phenylmethoxyethyl)pyrrolidine-1-carboxylate |
| SMILES | C=C[C@@]1(C=O)N(C(=O)OCc2ccccc2)C(=O)[C@H](CCOCc2ccccc2)[C@]1(C)O |
| InChI | InChI=1S/C25H27NO6/c1-3-25(18-27)24(2,30)21(14-15-31-16-19-10-6-4-7-11-19)22(28)26(25)23(29)32-17-20-12-8-5-9-13-20/h3-13,18,21,30H,1,14-17H2,2H3/t21-,24-,25-/m0/s1 |
| InChIKey | HFJPTIFUTBIXHW-TUSQITKMSA-N |
| XLogP | 3.26 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|