About 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine
2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 102417044) has the molecular formula C19H21ClN2
and a molecular weight of 312.84 g/mol. Its IUPAC name is 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine.
Molecular Properties
| Compound Name | 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine |
| PubChem CID | 102417044 |
| Molecular Formula | C19H21ClN2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | CCc1cccc(CC)c1/N=C1\CCCc2ccc(Cl)nc21 |
| InChI | InChI=1S/C19H21ClN2/c1-3-13-7-5-8-14(4-2)18(13)21-16-10-6-9-15-11-12-17(20)22-19(15)16/h5,7-8,11-12H,3-4,6,9-10H2,1-2H3/b21-16+ |
| InChIKey | UHXNREXMLYHBGM-LTGZKZEYSA-N |
| XLogP | 5.32 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine?
The IUPAC name of 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine (CID 102417044) is 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine.
What is the SMILES notation for 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine?
The canonical SMILES for 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine is CCc1cccc(CC)c1/N=C1\CCCc2ccc(Cl)nc21.
What is the InChIKey of 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine?
The InChIKey is UHXNREXMLYHBGM-LTGZKZEYSA-N. The full InChI is InChI=1S/C19H21ClN2/c1-3-13-7-5-8-14(4-2)18(13)21-16-10-6-9-15-11-12-17(20)22-19(15)16/h5,7-8,11-12H,3-4,6,9-10H2,1-2H3/b21-16+.
What are the key properties of 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine?
2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine has a molecular weight of 312.84 g/mol, XLogP of 5.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(2,6-diethylphenyl)-6,7-dihydro-5H-quinolin-8-imine is sourced from PubChem (CID 102417044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).