About 6-chloro-2,2-dimethylchromene
6-chloro-2,2-dimethylchromene (PubChem CID 10241742) has the molecular formula C11H11ClO
and a molecular weight of 194.66 g/mol. Its IUPAC name is 6-chloro-2,2-dimethylchromene.
Molecular Properties
| Compound Name | 6-chloro-2,2-dimethylchromene |
| PubChem CID | 10241742 |
| Molecular Formula | C11H11ClO |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 6-chloro-2,2-dimethylchromene |
| SMILES | CC1(C)C=Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C11H11ClO/c1-11(2)6-5-8-7-9(12)3-4-10(8)13-11/h3-7H,1-2H3 |
| InChIKey | POHWVMUYMAAFBQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-chloro-2,2-dimethylchromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,2-dimethylchromene?
The IUPAC name of 6-chloro-2,2-dimethylchromene (CID 10241742) is 6-chloro-2,2-dimethylchromene.
What is the SMILES notation for 6-chloro-2,2-dimethylchromene?
The canonical SMILES for 6-chloro-2,2-dimethylchromene is CC1(C)C=Cc2cc(Cl)ccc2O1.
What is the InChIKey of 6-chloro-2,2-dimethylchromene?
The InChIKey is POHWVMUYMAAFBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClO/c1-11(2)6-5-8-7-9(12)3-4-10(8)13-11/h3-7H,1-2H3.
What are the key properties of 6-chloro-2,2-dimethylchromene?
6-chloro-2,2-dimethylchromene has a molecular weight of 194.66 g/mol, XLogP of 3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,2-dimethylchromene is sourced from PubChem (CID 10241742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).