C15H19NO7 — CID 102417459
methyl 5-[(2S,3S,4R)-3,4-diacetyloxyoxolan-2-yl]-2-methyl-1H-pyrrole-3-carboxylate (PubChem CID 102417459) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is methyl 5-[(2S,3S,4R)-3,4-diacetyloxyoxolan-2-yl]-2-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[(2S,3S,4R)-3,4-diacetyloxyoxolan-2-yl]-2-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 102417459 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | methyl 5-[(2S,3S,4R)-3,4-diacetyloxyoxolan-2-yl]-2-methyl-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1cc([C@@H]2OC[C@@H](OC(C)=O)[C@H]2OC(C)=O)[nH]c1C |
| InChI | InChI=1S/C15H19NO7/c1-7-10(15(19)20-4)5-11(16-7)13-14(23-9(3)18)12(6-21-13)22-8(2)17/h5,12-14,16H,6H2,1-4H3/t12-,13+,14-/m1/s1 |
| InChIKey | MRJFNKUSIVXKIQ-HZSPNIEDSA-N |
| XLogP | 1.04 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|