C20H22N2O7 — CID 102417464
ethyl 5-[(2S,3S,4R)-3,4-diacetyloxyoxolan-2-yl]-2-pyridin-4-yl-1H-pyrrole-3-carboxylate (PubChem CID 102417464) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is ethyl 5-[(2S,3S,4R)-3,4-diacetyloxyoxolan-2-yl]-2-pyridin-4-yl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[(2S,3S,4R)-3,4-diacetyloxyoxolan-2-yl]-2-pyridin-4-yl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 102417464 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | ethyl 5-[(2S,3S,4R)-3,4-diacetyloxyoxolan-2-yl]-2-pyridin-4-yl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc([C@@H]2OC[C@@H](OC(C)=O)[C@H]2OC(C)=O)[nH]c1-c1ccncc1 |
| InChI | InChI=1S/C20H22N2O7/c1-4-26-20(25)14-9-15(22-17(14)13-5-7-21-8-6-13)18-19(29-12(3)24)16(10-27-18)28-11(2)23/h5-9,16,18-19,22H,4,10H2,1-3H3/t16-,18+,19-/m1/s1 |
| InChIKey | YVDJYAHGEJVDNA-NZSAHSFTSA-N |
| XLogP | 2.19 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|