About (2S,3S)-2-amino-5-phenylpentane-1,3-diol
(2S,3S)-2-amino-5-phenylpentane-1,3-diol (PubChem CID 10241753) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is (2S,3S)-2-amino-5-phenylpentane-1,3-diol.
Molecular Properties
| Compound Name | (2S,3S)-2-amino-5-phenylpentane-1,3-diol |
| PubChem CID | 10241753 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (2S,3S)-2-amino-5-phenylpentane-1,3-diol |
| SMILES | N[C@@H](CO)[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C11H17NO2/c12-10(8-13)11(14)7-6-9-4-2-1-3-5-9/h1-5,10-11,13-14H,6-8,12H2/t10-,11-/m0/s1 |
| InChIKey | ZWIBASUVFXTOOX-QWRGUYRKSA-N |
| XLogP | 0.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3S)-2-amino-5-phenylpentane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-amino-5-phenylpentane-1,3-diol?
The IUPAC name of (2S,3S)-2-amino-5-phenylpentane-1,3-diol (CID 10241753) is (2S,3S)-2-amino-5-phenylpentane-1,3-diol.
What is the SMILES notation for (2S,3S)-2-amino-5-phenylpentane-1,3-diol?
The canonical SMILES for (2S,3S)-2-amino-5-phenylpentane-1,3-diol is N[C@@H](CO)[C@@H](O)CCc1ccccc1.
What is the InChIKey of (2S,3S)-2-amino-5-phenylpentane-1,3-diol?
The InChIKey is ZWIBASUVFXTOOX-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H17NO2/c12-10(8-13)11(14)7-6-9-4-2-1-3-5-9/h1-5,10-11,13-14H,6-8,12H2/t10-,11-/m0/s1.
What are the key properties of (2S,3S)-2-amino-5-phenylpentane-1,3-diol?
(2S,3S)-2-amino-5-phenylpentane-1,3-diol has a molecular weight of 195.26 g/mol, XLogP of 0.30, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-amino-5-phenylpentane-1,3-diol is sourced from PubChem (CID 10241753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).