About 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine
2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine (PubChem CID 102417810) has the molecular formula C35H27N3O3
and a molecular weight of 537.62 g/mol. Its IUPAC name is 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine.
Molecular Properties
| Compound Name | 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine |
| PubChem CID | 102417810 |
| Molecular Formula | C35H27N3O3 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine |
| SMILES | CC(c1ccc(Oc2ccccn2)cc1)(c1ccc(Oc2ccccn2)cc1)c1ccc(Oc2ccccn2)cc1 |
| InChI | InChI=1S/C35H27N3O3/c1-35(26-11-17-29(18-12-26)39-32-8-2-5-23-36-32,27-13-19-30(20-14-27)40-33-9-3-6-24-37-33)28-15-21-31(22-16-28)41-34-10-4-7-25-38-34/h2-25H,1H3 |
| InChIKey | OTCPKQYDDRHGRG-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine?
The IUPAC name of 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine (CID 102417810) is 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine.
What is the SMILES notation for 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine?
The canonical SMILES for 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine is CC(c1ccc(Oc2ccccn2)cc1)(c1ccc(Oc2ccccn2)cc1)c1ccc(Oc2ccccn2)cc1.
What is the InChIKey of 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine?
The InChIKey is OTCPKQYDDRHGRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H27N3O3/c1-35(26-11-17-29(18-12-26)39-32-8-2-5-23-36-32,27-13-19-30(20-14-27)40-33-9-3-6-24-37-33)28-15-21-31(22-16-28)41-34-10-4-7-25-38-34/h2-25H,1H3.
What are the key properties of 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine?
2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine has a molecular weight of 537.62 g/mol, XLogP of 8.60, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[1,1-bis(4-pyridin-2-yloxyphenyl)ethyl]phenoxy]pyridine is sourced from PubChem (CID 102417810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).