C16H18N2O2 — CID 102417939
tert-butyl 4,5-dihydrobenzo[g]indazole-2-carboxylate (PubChem CID 102417939) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is tert-butyl 4,5-dihydrobenzo[g]indazole-2-carboxylate.
| Compound Name | tert-butyl 4,5-dihydrobenzo[g]indazole-2-carboxylate |
|---|---|
| PubChem CID | 102417939 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | tert-butyl 4,5-dihydrobenzo[g]indazole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc2c(n1)-c1ccccc1CC2 |
| InChI | InChI=1S/C16H18N2O2/c1-16(2,3)20-15(19)18-10-12-9-8-11-6-4-5-7-13(11)14(12)17-18/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | JXAFITZKWRNLDD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |