C9H11F6N2O4S+ — CID 102418047
1,1,1,2,3,3-hexafluoro-3-[2-(3-methyl-1H-imidazole-1,3-diium-1-yl)ethoxy]propane-2-sulfonate (PubChem CID 102418047) has the molecular formula C9H11F6N2O4S+ and a molecular weight of 357.25 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-[2-(3-methyl-1H-imidazole-1,3-diium-1-yl)ethoxy]propane-2-sulfonate.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-[2-(3-methyl-1H-imidazole-1,3-diium-1-yl)ethoxy]propane-2-sulfonate |
|---|---|
| PubChem CID | 102418047 |
| Molecular Formula | C9H11F6N2O4S+ |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-[2-(3-methyl-1H-imidazole-1,3-diium-1-yl)ethoxy]propane-2-sulfonate |
| SMILES | C[N+]1=C[NH+](CCOC(F)(F)C(F)(C(F)(F)F)S(=O)(=O)[O-])C=C1 |
| InChI | InChI=1S/C9H10F6N2O4S/c1-16-2-3-17(6-16)4-5-21-9(14,15)7(10,8(11,12)13)22(18,19)20/h2-3,6H,4-5H2,1H3/p+1 |
| InChIKey | UJXFKDRKLBBKLB-UHFFFAOYSA-O |
| XLogP | -0.59 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|