About 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine
5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine (PubChem CID 10241878) has the molecular formula C9H17N3S
and a molecular weight of 199.32 g/mol. Its IUPAC name is 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine |
| PubChem CID | 10241878 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCC(CC)CCc1nnc(N)s1 |
| InChI | InChI=1S/C9H17N3S/c1-3-7(4-2)5-6-8-11-12-9(10)13-8/h7H,3-6H2,1-2H3,(H2,10,12) |
| InChIKey | STZZYJXQYFSPTB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine (CID 10241878) is 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine is CCC(CC)CCc1nnc(N)s1.
What is the InChIKey of 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine?
The InChIKey is STZZYJXQYFSPTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3S/c1-3-7(4-2)5-6-8-11-12-9(10)13-8/h7H,3-6H2,1-2H3,(H2,10,12).
What are the key properties of 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine?
5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine has a molecular weight of 199.32 g/mol, XLogP of 2.49, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-ethylpentyl)-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 10241878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).