C10H16O4 — CID 10241889
(5S,6R,8S,9R)-6,8,9-trimethyl-1,3,10-trioxaspiro[4.5]decan-2-one (PubChem CID 10241889) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (5S,6R,8S,9R)-6,8,9-trimethyl-1,3,10-trioxaspiro[4.5]decan-2-one.
| Compound Name | (5S,6R,8S,9R)-6,8,9-trimethyl-1,3,10-trioxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 10241889 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (5S,6R,8S,9R)-6,8,9-trimethyl-1,3,10-trioxaspiro[4.5]decan-2-one |
| SMILES | C[C@@H]1C[C@H](C)[C@@H](C)O[C@@]12COC(=O)O2 |
| InChI | InChI=1S/C10H16O4/c1-6-4-7(2)10(13-8(6)3)5-12-9(11)14-10/h6-8H,4-5H2,1-3H3/t6-,7+,8+,10+/m0/s1 |
| InChIKey | JCNDEFXBVLETSX-OKJYPTKPSA-N |
| XLogP | 1.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |