About 6-(tert-butylamino)pyridine-2,3-dicarbonitrile
6-(tert-butylamino)pyridine-2,3-dicarbonitrile (PubChem CID 10241897) has the molecular formula C11H12N4
and a molecular weight of 200.24 g/mol. Its IUPAC name is 6-(tert-butylamino)pyridine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 6-(tert-butylamino)pyridine-2,3-dicarbonitrile |
| PubChem CID | 10241897 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 6-(tert-butylamino)pyridine-2,3-dicarbonitrile |
| SMILES | CC(C)(C)Nc1ccc(C#N)c(C#N)n1 |
| InChI | InChI=1S/C11H12N4/c1-11(2,3)15-10-5-4-8(6-12)9(7-13)14-10/h4-5H,1-3H3,(H,14,15) |
| InChIKey | FMFKWMUXJHLWOU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(tert-butylamino)pyridine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(tert-butylamino)pyridine-2,3-dicarbonitrile?
The IUPAC name of 6-(tert-butylamino)pyridine-2,3-dicarbonitrile (CID 10241897) is 6-(tert-butylamino)pyridine-2,3-dicarbonitrile.
What is the SMILES notation for 6-(tert-butylamino)pyridine-2,3-dicarbonitrile?
The canonical SMILES for 6-(tert-butylamino)pyridine-2,3-dicarbonitrile is CC(C)(C)Nc1ccc(C#N)c(C#N)n1.
What is the InChIKey of 6-(tert-butylamino)pyridine-2,3-dicarbonitrile?
The InChIKey is FMFKWMUXJHLWOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4/c1-11(2,3)15-10-5-4-8(6-12)9(7-13)14-10/h4-5H,1-3H3,(H,14,15).
What are the key properties of 6-(tert-butylamino)pyridine-2,3-dicarbonitrile?
6-(tert-butylamino)pyridine-2,3-dicarbonitrile has a molecular weight of 200.24 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(tert-butylamino)pyridine-2,3-dicarbonitrile is sourced from PubChem (CID 10241897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).