About [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane
[(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane (PubChem CID 102419459) has the molecular formula C17H37N3O2Si2
and a molecular weight of 371.67 g/mol. Its IUPAC name is [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane.
Molecular Properties
| Compound Name | [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane |
| PubChem CID | 102419459 |
| Molecular Formula | C17H37N3O2Si2 |
| Molecular Weight | 371.67 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)O/C=C/[C@H](CCN=[N+]=[N-])O[Si](CC)(CC)CC |
| InChI | InChI=1S/C17H37N3O2Si2/c1-7-23(8-2,9-3)21-16-14-17(13-15-19-20-18)22-24(10-4,11-5)12-6/h14,16-17H,7-13,15H2,1-6H3/b16-14+/t17-/m0/s1 |
| InChIKey | UBGGJDZNLYHUDH-ZQHZRZASSA-N |
| XLogP | 6.61 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.67 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane?
The IUPAC name of [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane (CID 102419459) is [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane.
What is the SMILES notation for [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane?
The canonical SMILES for [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane is CC[Si](CC)(CC)O/C=C/[C@H](CCN=[N+]=[N-])O[Si](CC)(CC)CC.
What is the InChIKey of [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane?
The InChIKey is UBGGJDZNLYHUDH-ZQHZRZASSA-N. The full InChI is InChI=1S/C17H37N3O2Si2/c1-7-23(8-2,9-3)21-16-14-17(13-15-19-20-18)22-24(10-4,11-5)12-6/h14,16-17H,7-13,15H2,1-6H3/b16-14+/t17-/m0/s1.
What are the key properties of [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane?
[(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane has a molecular weight of 371.67 g/mol, XLogP of 6.61, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,3S)-5-azido-3-triethylsilyloxypent-1-enoxy]-triethylsilane is sourced from PubChem (CID 102419459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).