C19H22N2O — CID 102419706
(1R,3S,4S)-3-(4-isocyanophenyl)-7,7-dimethyl-2-prop-2-enyl-2-azabicyclo[2.2.2]octan-5-one (PubChem CID 102419706) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (1R,3S,4S)-3-(4-isocyanophenyl)-7,7-dimethyl-2-prop-2-enyl-2-azabicyclo[2.2.2]octan-5-one.
| Compound Name | (1R,3S,4S)-3-(4-isocyanophenyl)-7,7-dimethyl-2-prop-2-enyl-2-azabicyclo[2.2.2]octan-5-one |
|---|---|
| PubChem CID | 102419706 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (1R,3S,4S)-3-(4-isocyanophenyl)-7,7-dimethyl-2-prop-2-enyl-2-azabicyclo[2.2.2]octan-5-one |
| SMILES | [C-]#[N+]c1ccc([C@@H]2[C@@H]3CC(C)(C)[C@@H](CC3=O)N2CC=C)cc1 |
| InChI | InChI=1S/C19H22N2O/c1-5-10-21-17-11-16(22)15(12-19(17,2)3)18(21)13-6-8-14(20-4)9-7-13/h5-9,15,17-18H,1,10-12H2,2-3H3/t15-,17-,18-/m1/s1 |
| InChIKey | VLTKWEUCOROKPX-KBAYOESNSA-N |
| XLogP | 4.15 |
| TPSA | 24.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|