C17H29N5O — CID 102420042
N-[(1S)-1-phenylethyl]-1,4,7,10-tetrazacyclododecane-1-carboxamide (PubChem CID 102420042) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is N-[(1S)-1-phenylethyl]-1,4,7,10-tetrazacyclododecane-1-carboxamide.
| Compound Name | N-[(1S)-1-phenylethyl]-1,4,7,10-tetrazacyclododecane-1-carboxamide |
|---|---|
| PubChem CID | 102420042 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | N-[(1S)-1-phenylethyl]-1,4,7,10-tetrazacyclododecane-1-carboxamide |
| SMILES | C[C@H](NC(=O)N1CCNCCNCCNCC1)c1ccccc1 |
| InChI | InChI=1S/C17H29N5O/c1-15(16-5-3-2-4-6-16)21-17(23)22-13-11-19-9-7-18-8-10-20-12-14-22/h2-6,15,18-20H,7-14H2,1H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | ACHBNXGHKPFQOY-HNNXBMFYSA-N |
| XLogP | 0.54 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |