C36H38N8O6 — CID 102420715
2,9-bis[4-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]phenyl]-1,10-phenanthroline (PubChem CID 102420715) has the molecular formula C36H38N8O6 and a molecular weight of 678.75 g/mol. Its IUPAC name is 2,9-bis[4-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]phenyl]-1,10-phenanthroline.
| Compound Name | 2,9-bis[4-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 102420715 |
| Molecular Formula | C36H38N8O6 |
| Molecular Weight | 678.75 g/mol |
| Exact Mass | 678.29 |
| IUPAC Name | 2,9-bis[4-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]phenyl]-1,10-phenanthroline |
| SMILES | [N-]=[N+]=NCCOCCOCCOc1ccc(-c2ccc3ccc4ccc(-c5ccc(OCCOCCOCCN=[N+]=[N-])cc5)nc4c3n2)cc1 |
| InChI | InChI=1S/C36H38N8O6/c37-43-39-15-17-45-19-21-47-23-25-49-31-9-3-27(4-10-31)33-13-7-29-1-2-30-8-14-34(42-36(30)35(29)41-33)28-5-11-32(12-6-28)50-26-24-48-22-20-46-18-16-40-44-38/h1-14H,15-26H2 |
| InChIKey | JJQZUDQCZSRHIC-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 178.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.75 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|