About 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine
2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine (PubChem CID 102421066) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine.
Molecular Properties
| Compound Name | 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine |
| PubChem CID | 102421066 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine |
| SMILES | CC1=CCN=C(c2cc(C)oc2C)O1 |
| InChI | InChI=1S/C11H13NO2/c1-7-4-5-12-11(14-7)10-6-8(2)13-9(10)3/h4,6H,5H2,1-3H3 |
| InChIKey | WDXGCEHDMSYGLT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine?
The IUPAC name of 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine (CID 102421066) is 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine.
What is the SMILES notation for 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine?
The canonical SMILES for 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine is CC1=CCN=C(c2cc(C)oc2C)O1.
What is the InChIKey of 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine?
The InChIKey is WDXGCEHDMSYGLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-7-4-5-12-11(14-7)10-6-8(2)13-9(10)3/h4,6H,5H2,1-3H3.
What are the key properties of 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine?
2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine has a molecular weight of 191.23 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylfuran-3-yl)-6-methyl-4H-1,3-oxazine is sourced from PubChem (CID 102421066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).