C22H26O3S — CID 102421456
(1S,2S,3R)-3-(benzenesulfonyl)-3-ethenyl-1-methyl-2-(2-phenylethyl)cyclopentan-1-ol (PubChem CID 102421456) has the molecular formula C22H26O3S and a molecular weight of 370.51 g/mol. Its IUPAC name is (1S,2S,3R)-3-(benzenesulfonyl)-3-ethenyl-1-methyl-2-(2-phenylethyl)cyclopentan-1-ol.
| Compound Name | (1S,2S,3R)-3-(benzenesulfonyl)-3-ethenyl-1-methyl-2-(2-phenylethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102421456 |
| Molecular Formula | C22H26O3S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (1S,2S,3R)-3-(benzenesulfonyl)-3-ethenyl-1-methyl-2-(2-phenylethyl)cyclopentan-1-ol |
| SMILES | C=C[C@]1(S(=O)(=O)c2ccccc2)CC[C@](C)(O)[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C22H26O3S/c1-3-22(26(24,25)19-12-8-5-9-13-19)17-16-21(2,23)20(22)15-14-18-10-6-4-7-11-18/h3-13,20,23H,1,14-17H2,2H3/t20-,21-,22-/m0/s1 |
| InChIKey | JNNVPUMSJAYVSY-FKBYEOEOSA-N |
| XLogP | 4.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|