C18H28N2O2S — CID 102421613
methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(1S)-1-phenylethyl]butanimidothioate (PubChem CID 102421613) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(1S)-1-phenylethyl]butanimidothioate.
| Compound Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(1S)-1-phenylethyl]butanimidothioate |
|---|---|
| PubChem CID | 102421613 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-N-[(1S)-1-phenylethyl]butanimidothioate |
| SMILES | CC[C@H](NC(=O)OC(C)(C)C)/C(=N/[C@@H](C)c1ccccc1)SC |
| InChI | InChI=1S/C18H28N2O2S/c1-7-15(20-17(21)22-18(3,4)5)16(23-6)19-13(2)14-11-9-8-10-12-14/h8-13,15H,7H2,1-6H3,(H,20,21)/b19-16-/t13-,15-/m0/s1 |
| InChIKey | QVKIDTNITSSFSG-RPIVUQGMSA-N |
| XLogP | 4.81 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|