C19H19NO3 — CID 102421783
(1S,2R,3S,5R)-2-naphthalen-1-yl-3-nitrobicyclo[3.3.1]nonan-9-one (PubChem CID 102421783) has the molecular formula C19H19NO3 and a molecular weight of 309.36 g/mol. Its IUPAC name is (1S,2R,3S,5R)-2-naphthalen-1-yl-3-nitrobicyclo[3.3.1]nonan-9-one.
| Compound Name | (1S,2R,3S,5R)-2-naphthalen-1-yl-3-nitrobicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 102421783 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (1S,2R,3S,5R)-2-naphthalen-1-yl-3-nitrobicyclo[3.3.1]nonan-9-one |
| SMILES | O=C1[C@@H]2CCC[C@H]1[C@H](c1cccc3ccccc13)[C@@H]([N+](=O)[O-])C2 |
| InChI | InChI=1S/C19H19NO3/c21-19-13-7-4-10-16(19)18(17(11-13)20(22)23)15-9-3-6-12-5-1-2-8-14(12)15/h1-3,5-6,8-9,13,16-18H,4,7,10-11H2/t13-,16+,17+,18+/m1/s1 |
| InChIKey | GNDOGDVWHSJAQV-QCSYZSNVSA-N |
| XLogP | 3.96 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|