C12H19NO2 — CID 10242194
ethyl 2-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]acetate (PubChem CID 10242194) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is ethyl 2-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]acetate.
| Compound Name | ethyl 2-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]acetate |
|---|---|
| PubChem CID | 10242194 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | ethyl 2-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\C[C@H]2CC[C@@H](C1)N2C |
| InChI | InChI=1S/C12H19NO2/c1-3-15-12(14)8-9-6-10-4-5-11(7-9)13(10)2/h8,10-11H,3-7H2,1-2H3/b9-8-/t10-,11+/m0/s1 |
| InChIKey | SQNOQCVPMVYWBB-DOSOYNOZSA-N |
| XLogP | 1.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|